| Cas No.: | 1036069-26-7 |
| Chemical Name: | 2-((4,5-dihydrothiazol-2-yl)thio)-1-(3,4-dihydroxyphenyl)ethan-1-one |
| SMILES: | Cl.OC1=C(O)C=C(C=C1)C(=O)CSC2SCCN=2 |
| Formula: | C11H11NO3S2 |
| M.Wt: | 269.333 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | RETRA is a small molecule mutant p53 reactivator that activates a set of p53-regulated genes and specifically suppresses mutant p53-bearing tumor cells in vitro and in mouse xenograft; increases in the expression level of p73, releases p73 and poduces tumor-suppressor effects similar to the functional reactivation of p53; a p73 activator. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
