| Cas No.: | 1001908-89-9 |
| Chemical Name: | N-[2-[3-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]naphthalene-2-carboxamide |
| Synonyms: | SRT2183 |
| SMILES: | OC1CCN(CC2N3C=C(C4C=CC=CC=4NC(C4C=CC5C(=CC=CC=5)C=4)=O)N=C3SC=2)C1 |
| Formula: | C27H24N4O2S |
| M.Wt: | 468.575 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SRT 2183 is a potent, selective SIRT1 activator with EC1.5 of 0.36 uM, displays good selectivity for activation of SIRT1 versus SIRT2 and SIRT3 (EC1.5>300 uM) and is more potent than Resveratrol; improve insulin sensitivity, lower plasma glucose, and increase mitochondrial capacity in obese mice model. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
