| Cas No.: | 922507-80-0 |
| Chemical Name: | 1H-Pyrido[3,4-b]indole-1-carboxylic acid,2-(2-chloroacetyl)-2,3,4,9-tetrahydro-1-methyl-, methyl ester |
| Synonyms: | 1H-Pyrido[3,4-b]indole-1-carboxylic acid,2-(2-chloroacetyl)-2,3,4,9-tetrahydro-1-methyl-, methyl ester;methyl 2-(2-chloroacetyl)-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole-1-carboxylate |
| SMILES: | ClCC(N1CCC2C3=CC=CC=C3NC=2C1(C)C(OC)=O)=O |
| Formula: | C16H17ClN2O3 |
| M.Wt: | 320.770783185959 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A small molecule protein disulfide isomerase (PDI) inhibitor that suppress apoptosis induced by misfolded proteins; protects rat neurons from cell death triggered by Aβ peptide; reduces Zika virus replication in vitro but demonstrates notable toxicity; inhibits CHIKV E1-induced cell-cell fusion. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
