| Cas No.: | 1841464-21-8 |
| Chemical Name: | N-(4-fluorophenethyl)-4-(4-methyl-7-oxo-2-(p-tolyl)-2,7-dihydro-6H-pyrazolo[3,4-d]pyridazin-6-yl)butanamide |
| SMILES: | O=C(NCCC1=CC=C(F)C=C1)CCCN2N=C(C)C3=CN(C4=CC=C(C)C=C4)N=C3C2=O |
| Formula: | C25H26FN5O2 |
| M.Wt: | 447.50 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PDEδ-IN-99 is a novel potent K-Ras-PDEδ inhibitor that binds to the farnesyl binding pocket of PDEδ with Kd of 8±4 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
