| Cas No.: | 599150-20-6 |
| Chemical Name: | 2-Methoxyethyl 4-(3-hydroxyphenyl)-7-(2-methoxyphe nyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinolin |
| Synonyms: | 2-Methoxyethyl 4-(3-hydroxyphenyl)-7-(2-methoxyphe nyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinolin;2-Methoxyethyl 4-(3-hydroxyphenyl)-7-(2-methoxyphe nyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline;HPI 1;HPI-1;0130970;2-METHOXYETHYL 1,4,5,6,7,8-HEXAHYDRO-4-(3-HYDROXYPHENYL)-7-(2-METHOXYPHENYL)-2-METHYL-5-OXO-3-QUINOLINECARBOXYLATE;A3094;AC1MFWGY;CHEMBL1243339;MolPort-000-907-696;ST093553;STK403236;SureCN644336 |
| SMILES: | COCCN1C2=C(C(=O)CC(C3C=CC=CC=3OC)C2)C(C2C=CC=C(O)C=2)C=C1C |
| Formula: | C26H29NO4 |
| M.Wt: | 419.512767553329 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | HPI-1 is a Hedgehog (Hh) pathway inhibitor that suppresses signaling through Shh (IC50=1.5 uM) without significantly affecting Wnt signaling (IC50>30 uM); suppresses Hh activation induced by loss of Suppressor of Fused or by Gli overexpression; inhibits signaling through the oncogenic Smoothened (Smo) mutant SmoM2 in neuron precursors, preventing cell proliferation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
