| Cas No.: | 192185-71-0 |
| Chemical Name: | 2(1H)-Quinolinone, 6-[(S)-amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methyl- |
| Synonyms: | (S)-(-)-R-115777;IND-58359 S enantiomer |
| SMILES: | O=C1C=C(C2C=C(Cl)C=CC=2)C2C=C(C=CC=2N1C)C(C1N(C)C=NC=1)(N)C1C=CC(Cl)=CC=1 |
| Formula: | C27H22Cl2N4O |
| M.Wt: | 489.3958 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Tipifarnib S enantiomer is the S-enantiomer of Tipifarnib. Tipifarnib is a potent and specific farnesyltransferase (FTase) inhibitor with IC50 of 0.6 nM. Tipifarnib S enantiomer is the less active isomer. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
