| Cas No.: | 2230911-59-6 |
| Chemical Name: | PD-1/PD-L1-IN-8 |
| Synonyms: | PD-1/PD-L1-IN-8 |
| SMILES: | C(O)([C@H]1CN(CC2=CC3N=C(C4C=CC=C(C=4C)C4=C(C(NC5=C6N=CC(CN7CC[C@@H](O)C7)=CC6=CC=N5)=CC=C4)C)OC=3C(C#N)=C2)CC1)=O |
| Formula: | C41H39N7O4 |
| M.Wt: | 693.80 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | INCB086550 is an orally available, small molecule inhibitor of PD-L1 with potential immune checkpoint inhibitory and antineoplastic activities. In vitro, INCB086550 selectively and potently blocked the PD-L1/PD-1 interaction, induced PD-L1 dimerization and internalization, and induced stimulation-dependent cytokine production in primary human immune cells. In vivo, INCB086550 reduced tumor growth in CD34+ humanized mice and induced T-cell activation gene signatures, consistent with PD-L1/PD-1 pathway blockade. Preliminary data from an ongoing phase I study confirmed PD-L1/PD-1 blockade in peripheral blood cells, with increased immune activation and tumor growth control. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
