| Cas No.: | 2348493-39-8 |
| Chemical Name: | L-Alanine, N-[-3'-deoxy-P-phenyl-5'- adenylyl]-, phenylmethyl ester |
| Synonyms: | NUC-7738,NUC 7738,NUC7738 |
| SMILES: | C1=CC=CC(OP(=O)(OC[C@H]2C[C@H](O)[C@@H](N3C4N=CN=C(N)C=4N=C3)O2)N[C@H](C)C(OCC2=CC=CC=C2)=O)=C1 |
| Formula: | C26H29N6O7P |
| M.Wt: | 568.52 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | NUC-7738 is a phosphoramidate transformation of cordycepin (3’-deoxyadenosine; 3’-dA), a derivative of adenosine that was first isolated from Cordyceps sinensis. |
| In Vitro: | NUC-7738 is a ProTide transformation of cordycepin, a novel nucleoside analog. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
