| Cas No.: | 380422-12-8 |
| Chemical Name: | 3-(2,5-Dimethyl-1-phenyl-1H-pyrrol-3-yl)-6,7,8,9-tetrahydro-5H-1,2,4-triazolo[4,3-a]azepine |
| Synonyms: | 5H-1,2,4-Triazolo[4,3-a]azepine, 3-(2,5-dimethyl-1-phenyl-1H-pyrrol-3-yl)-6,7,8,9-tetrahydro- |
| SMILES: | C1C(=C(N(C2=CC=CC=C2)C=1C)C)C1=NN=C2CCCCCN12 |
| Formula: | C19H22N4 |
| M.Wt: | 306.40 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
