| Cas No.: | 67341-43-9 |
| Chemical Name: | UDP-2-deoxy-2-fluoro-D-glucose sodium salt |
| Synonyms: | uridine-2-deoxy-2-fluoro-D-glucose diphosphate ester;Udp-fglc;Udp-2-fluoro-2-deoxy-D-glucose;Uridine 5'-(trihydrogen diphosphate), mono(2-deoxy-2-fluoro-alpha-D-glucopyranosyl) ester;[[(2R,3S,4R)-5-(2,4-Dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R,4S;UDP-2-deoxy-2-fluoro-D-glucose sodium salt |
| SMILES: | P(=O)(O)(OP(=O)(O)OC1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)F)OC[C@@H]1[C@H]([C@H](C(N2C=CC(NC2=O)=O)O1)O)O |
| Formula: | C15H23FN2O16P2 |
| M.Wt: | 568.292850732803 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
