| Cas No.: | 1611490-64-2 |
| Chemical Name: | UDP-GlcNAz.2Na |
| Synonyms: | UDP-GlcNAz.2Na |
| SMILES: | O=C(C=CN1[C@H]2[C@H](O)[C@H](O)[C@@H](COP(OP(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3NC(CN=[N+]=[N-])=O)(O[Na])=O)(O[Na])=O)O2)NC1=O |
| Formula: | C17H27N6NaO17P2 |
| M.Wt: | 672.36 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | UDP-GlcNAz disodium is a substrate for UDP-GlcNAc:polypeptidyltransferase. UDP-GlcNAz serves as a sugar donor for the process catalyzed by the OGT enzyme and labels proteins through this process. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
