| Cas No.: | |
| Chemical Name: | EB-Lipid |
| Synonyms: | EBLipid,EB Lipid |
| SMILES: | CCCCCC/C=C\COC(=O)CCCCCCCN(CCCCCCCC(=O)OC/C=C\CCCCCC)C(=O)SCCCN(CC)CC |
| Formula: | C42H78O5N2S |
| M.Wt: | 723.15 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | Feng, Y., Tai, W., Huang, P. et al. Albumin-recruiting lipid nanoparticle potentiates the safety and efficacy of mRNA vaccines by avoiding liver accumulation. Nat. Mater. (2025). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
