| Cas No.: | 1819986-22-5 |
| Synonyms: | GSK3039294;GSK-3039294;GSK 3039294 |
| SMILES: | C1(CCOCC1)OC(=O)OCOC([C@H]1N(C(=O)CCCCC(=O)N2CCC[C@H]2C(=O)OCOC(=O)OC2CCOCC2)CCC1)=O |
| Formula: | C30H44N2O14 |
| M.Wt: | 656.68 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | pharmaceutical compositions comprising the same and the use of the same for treatment of diseases or disorders wherein depletion of serum amyloid P component (SAP) would be beneficial, including amyloidosis, Alzheimer's disease, type 2 diabetes mellitus and osteoarthritis. |
| References: | [1]. PCT Int. Appl. (2015), WO 2015165833 A1 20151105. [2]. U.S. Pat. Appl. Publ. (2016), US 20160081983 A1 20160324. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
