| Cas No.: | 1562024-11-6 |
| Chemical Name: | 2-({21-[(3',6'-Dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)amino]-21-thioxo-4,7,10,13,16-pentaoxa-20-azahenicos-1-yl}amino)-4-(3,6,6-trimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indazol-1-yl)ben zamide |
| Synonyms: | HS27;HS 27;2-[3-[2-[2-[2-[2-[3-[(3',6'-Dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino;2-({21-[(3',6'-Dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)amino]-21-thioxo-4,7,10,13,1;HS-27 |
| SMILES: | C12(C3C=CC(=CC=3OC3C=C(O)C=CC1=3)O)OC(=O)C1C=C(C=CC2=1)NC(NCCCOCCOCCOCCOCCOCCCNC1C=C(N2N=C(C)C3C(CC(C)(C)CC2=3)=O)C=CC=1C(N)=O)=S |
| Formula: | C52H60N6O12S |
| M.Wt: | 993.130812644959 |
| Purity: | 0.9 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Hs-27 is a Novel Hsp90 Inhibitor, Exhibits Diagnostic and Therapeutic Potential in Triple Negative Breast Cancer. |
| In Vitro: | HS-27 labels all receptor subtypes of breast cancer, but not normal cells, and specifically binds to Hsp90 expressed on the surface of breast cancer cells before being internalized. HS-27 fluorescence is greater in tumor than non-tumor tissue[1]. |
| References: | [1]. Crouch BT, et al. Exploiting heat shock protein expression to develop a non-invasive diagnostic tool for breast cancer. Sci Rep. 2019 Mar 5;9(1):3461. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
