| Cas No.: | 942655-44-9 |
| Chemical Name: | 3,4-dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)benzamide |
| Synonyms: | 3,4-Dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)-benzamide;JK-P3;3,4-dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)benzamide;BCP32785;N16805;Q27455260;4Y0;3,4-Dimethoxy-N-(5-phenyl-1H-pyrazol-3-yl)benzamide (ACI);3,4-Dimethoxy-N-(3-phenyl-1H-pyrazol-5-yl)benzamide |
| SMILES: | O(C)C1=C(C=CC(=C1)C(NC1C=C(C2C=CC=CC=2)NN=1)=O)OC |
| Formula: | C18H17N3O3 |
| M.Wt: | 323.352 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | JK-P3 is a VEGFR-2 inhibitor. JK-P3 is a pyrazole-based inhibitor of VEGFR-2 (IC50 = 7.8 μM). JK-P3 inhibits FGFR 1/3 kinase activity in vitro, but has no effect on FGFR signaling in cell-based assays. The compound blocks wound healing and tube formation in HUVEC without effecting endothelial cell proliferation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
