| Cas No.: | 2166616-75-5 |
| Chemical Name: | (R)-4-fluoro-N-(1-(1-(tetrahydro-2H-pyran-4-carbonyl)indolin-5-yl)ethyl)benzamide |
| Synonyms: | LY-3381916; LY 3381916; LY 3381916; IDO1-IN-5; IDO1-IN-5; IDO1 IN-5; IDO1-IN5; IDO1IN5; IDO1 IN5; |
| SMILES: | FC1=CC=C(C(N[C@H](C)C2=CC=C(N(C(C3CCOCC3)=O)CC4)C4=C2)=O)C=C1 |
| Formula: | C23H25FN2O3 |
| M.Wt: | 396.4624 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LY-3381916 is a potent, selective and brain penetrated inhibitor of IDO1 activity, binds to apo-IDO1 lacking heme rather than mature heme-bound IDO1[1]. |
| Target: | IDO1 |
| In Vitro: | LY-3381916 (up to 100 µM) shows no obvious agonism of aryl hydrocarbon receptor (AHR)[1]. |
| References: | [1]. Frank C. Dorsey, et al. Abstract 5245: Identification and characterization of the IDO1 inhibitor LY3381916. Cancer Research. 2018, 78(13). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
