| Cas No.: | 1391052-94-0 |
| Chemical Name: | 4-Dechloro-4-(4-chlorophenyl) Loperamide |
| Synonyms: | 4-Dechloro-4-(4-chlorophenyl) Loperamide |
| SMILES: | ClC1C=CC(C2C=CC(C3(CCN(CCC(C4C=CC=CC=4)(C(N(C)C)=O)C4C=CC=CC=4)CC3)O)=CC=2)=CC=1 |
| Formula: | C35H37N2O2Cl |
| M.Wt: | 553.13348 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
