| Cas No.: | 2296727-52-9 |
| Chemical Name: | 2-(5-methyl-4-(4-(2,2,2-trifluoroethyl)piperidine-1-carbonyl)-1H-pyrazol-1-yl)pyrrolo[2,1-f][1,2,4]triazin-4(3H)-one |
| Synonyms: | QM385,QM-385,QM 385,BH4 inhibitor,SPR inhibitor |
| SMILES: | O=C1NC(N2N=CC(C(N3CCC(CC(F)(F)F)CC3)=O)=C2C)=NN4C1=CC=C4 |
| Formula: | C18H19F3N6O2 |
| M.Wt: | 408.385 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
