| Cas No.: | 329218-11-3 |
| Synonyms: | Quetiapine sulfoxide dihydrochloride; Quetiapine S-oxide dihydrochloride |
| SMILES: | OCCOCCN1CCN(C2C3C=CC=CC=3S(=O)C3C=CC=CC=3N=2)CC1.Cl[H].Cl[H] |
| Formula: | C21H27Cl2N3O3S |
| M.Wt: | 472.43 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
