| Cas No.: | 1125780-41-7 |
| Chemical Name: | SKLB 610; SKLB-610 |
| Synonyms: | SKLB 610; SKLB-610 |
| SMILES: | C(C(NC)=O)1=NC=CC(OC2=CC=C(NC(=O)C3=CC=CC(C(F)(F)F)=C3)C=C2)=C1 |
| Formula: | C21H16F3N3O3 |
| M.Wt: | 415.37 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SKLB610, a novel multi-targeted inhibitor, inhibits angiogenesis-related tyrosine kinase VEGFR2, FGFR2 and PDGFR at rate of 97%, 65% and 55%, respectively, at concentration of 10 μM in biochemical kinase assays. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
