| Cas No.: | 2055101-86-3 |
| Chemical Name: | N-(3-bromophenethyl)-2-((5-chloropyridin-2-yl)amino)acetamide |
| Synonyms: | SR 12343;SR-12343 |
| SMILES: | C(NCCC1=CC=CC(Br)=C1)(=O)CNC1=NC=C(Cl)C=C1 |
| Formula: | C15H15BrClN3O |
| M.Wt: | 368.659 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SR12343 (SR-12343) is a novel NF-κB essential modulator (NEMO)-binding domain (NBD) mimetic for inhibiting IKK/NF-κB activation, inhibits TNF-α-mediated NF-κB activation with IC50 of 11.34 uM in luciferase assays; inhibits lipopolysaccharide (LPS)-induced NF-κB activation by blocking the interaction between IKKβ and NEMO, significantly inhibits COX-2, IL-6, and iNOS expression at 50 uM in cellular assays; suppresses LPS-induced acute pulmonary inflammation, alleviates necrosis and muscle degeneration in mdx mice without overt liver toxicity. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
