| Cas No.: | 265114-23-6 |
| Chemical Name: | 4-[4-Chloro-5-(3-fluoro-4-methoxyphenyl)-1H-imidazol-1-yl]benzenesulfonamide |
| Synonyms: | UR-8880; UR8880; UR8880; Cimicoxib; trade name: Cimalgex. |
| SMILES: | O=S(C1=CC=C(N2C(C3=CC=C(OC)C(F)=C3)=C(Cl)N=C2)C=C1)(N)=O |
| Formula: | C16H13ClFN3O3S |
| M.Wt: | 381.8064 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Cimicoxib, aslo known as UR-8880, is a non-steroidal anti-inflammatory drug (NSAID) used in veterinary medicine to treat dogs for pain and inflammation associated with osteoarthritis and for the management of pain and inflammation associated with surgery. It acts as a COX-2 inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
