| Cas No.: | 1268490-12-5 |
| Chemical Name: | Urea, N-[3,5-dichloro-4-[[6-(methylamino)-4-pyrimidinyl]oxy]phenyl]-N'-[3-(trifluoromethyl)phenyl]- |
| Synonyms: | Urea, N-[3,5-dichloro-4-[[6-(methylamino)-4-pyrimidinyl]oxy]phenyl]-N'-[3-(trifluoromethyl)phenyl]-;GSK 329;GSK329;GSK-329 |
| SMILES: | N(C1=CC(Cl)=C(OC2C=C(NC)N=CN=2)C(Cl)=C1)C(NC1=CC=CC(C(F)(F)F)=C1)=O |
| Formula: | C19H14Cl2F3N5O2 |
| M.Wt: | 472.25 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
