| Cas No.: | 1781934-44-8 |
| Chemical Name: | NPS ALX Compound 4a dihydrochloride |
| SMILES: | O=S(N1C=CC2=C1C=C(N3CC(CCC4)N4CC3)C=C2)(C5=C6C=CC=CC6=CC=C5)=O.[H]Cl.[H]Cl |
| Formula: | C25H27Cl2N3O2S |
| M.Wt: | 504.47 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
