| Cas No.: | 2803699-72-9 |
| Chemical Name: | 113-O12B |
| Synonyms: | 113O12B, 113 O12B |
| SMILES: | N(CCC(OCCSSCCCCCCCC)=O)(CCC(=O)OCCSSCCCCCCCC)CCN(C)CCN(CCC(=O)OCCSSCCCCCCCC)CCC(=O)OCCSSCCCCCCCC |
| Formula: | C57H111N3O8S8 |
| M.Wt: | 1223.03 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Lipid nanoparticle-mediated lymph node–targeting delivery of mRNA cancer vaccine elicits robust CD8+T cell response. PNAS, (2022), 119, 34, e2207841119. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.gif)