To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 23256-50-0 |
| Chemical Name: | Hydrazinecarboximidamide, 2-[(2,6-dichlorophenyl)methylene]-, monoacetate (9CI) |
| Synonyms: | Wytensin;WY-8678 acetate |
| SMILES: | N(C(N)=N)/N=C/C1=C(Cl)C=CC=C1Cl.C(O)(=O)C |
| Formula: | C10H12Cl2N4O2 |
| M.Wt: | 291.132 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | R15A inhibitor |
