To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1262131-60-1 |
| Chemical Name: | (7-hydroxy-5-phenethyl-[1,2,4]triazolo[1,5-a]pyridine-8-carbonyl)glycine hydrochloride |
| Synonyms: | JTZ 951;JTZ951;Enarodustat |
| SMILES: | C(O)(=O)CNC(C1=C(O)C=C(CCC2=CC=CC=C2)N2N=CN=C12)=O.[H]Cl |
| Formula: | C17H17ClN4O4 |
| M.Wt: | 376.797 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent, orally active HIF prolyl hydroxylase (PHD) inhibitor with IC50 of 0.22 uM for PHD2; increases EPO release from Hep3B cells with EC50 of 5.7 uM, increases hemoglobin levels in rats. |