| Cas No.: | 340014-88-2 |
| Chemical Name: | 1-((2,4-diphenyl-4H-chromen-3-yl)methyl)piperidine |
| Synonyms: | AX000;AX 000 |
| SMILES: | N(CC1C(C2=CC=CC=C2)C2=C(OC=1C1=CC=CC=C1)C=CC=C2)1CCCCC1 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A hit compound that inhibits the proliferation of human peripheral blood T cells stimulated with anti-CD3 with IC50 of <10 nM, inhibits TCR-Nck interaction. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
