| Cas No.: | 644981-35-1 |
| Chemical Name: | L-Valinamide, N-methyl-N-[[[4-[[L-valyl-N5-(aminocarbonyl)-L-ornithyl]amino]phenyl]methoxy]carbonyl]-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1R,2S)-2-hydroxy-1-methyl-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S |
| SMILES: | CCC(C(N(C)C(=O)C(NC(=O)C(N(C)C(=O)OCC1C=CC(NC(=O)C(NC(=O)C(N)C(C)C)CCCNC(=O)N)=CC=1)C(C)C)C(C)C)C(OC)CC(=O)N1CCCC1C(OC)C(C(=O)NC(C(C1C=CC=CC=1)O)C)C)C |
| Formula: | C58H94N10O12 |
| M.Wt: | 1123.427 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Val-Cit-PAB-MMAE is a drug-linker conjugate for ADC by using the anti-mitotic agent, monomethyl auristatin E (MMAE), linked via the peptide Val-Cit-PAB. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
