| Cas No.: | 2110426-27-0 |
| Chemical Name: | JNJ-63576253 |
| Synonyms: | 5-[8-Oxo-5-[6-(4-piperidinyloxy)-3-pyridinyl]-6-thioxo-5,7-diazaspiro[3.4]oct-7-yl]-3-(trifluoromethyl)-2-pyridinecarbonitrile |
| SMILES: | C(F)(F)(C1=CC(N2C(N(C3C=CC(=NC=3)OC3CCNCC3)C3(CCC3)C2=O)=S)=CN=C1C#N)F |
| Formula: | C23H21F3N6O2S |
| M.Wt: | 502.516 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
