| Cas No.: | 245329-02-6 |
| Chemical Name: | L-Tyrosinamide, L-phenylalanyl-L-seryl-L-leucyl-L-leucyl-L-arginyl- |
| Synonyms: | L-Tyrosinamide, L-phenylalanyl-L-seryl-L-leucyl-L-leucyl-L-arginyl-;H-PHE-SER-LEU-LEU-ARG-TYR-NH2;FSLLRY-NH2;(PHE1,SER2,TYR6)-PAR-1 (1-6) AMIDE (HUMAN);FSLLRYaMide, (Phe1,Ser2,Tyr6)-Coagulation Factor II Receptor (1-6) aMide (Mouse), (Phe1,Ser2,Tyr6)-Proteinase Activated Receptor 1 (1-6) aMide (huMan), (Phe1,Ser2,Tyr6)-ThroMbin Receptor (1-6) aMide (huMan);L-Phenylalanyl-L-seryl-L-leucyl-L-leucyl-L-arginyl-L-tyrosinamide;(Phe1,Ser2,Tyr6)-PAR-1 (1-6) amide (human) FSLLRYamide, (Phe1,Ser2,Tyr6)-Coagulation Factor II Recep;FSLLRY-amide;L-Phenylalanyl-L-ser |
| SMILES: | NC(C(NC(C(NC(C(NC(C(NC(C(NC(C(N)=O)CC1C=CC(O)=CC=1)=O)CCCNC(=N)N)=O)CC(C)C)=O)CC(C)C)=O)CO)=O)CC1C=CC=CC=1 |
| Formula: | C39H60N10O8 |
| M.Wt: | 796.95590877533 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
