| Cas No.: | 165800-03-3 |
| Chemical Name: | (8S,10S)-10-(((2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-6,8,11-trihydroxy-8-(2-hydroxyacetyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione hydrochloride |
| Synonyms: | Zyvoxid, Zyvoxam |
| SMILES: | O=C(O1)N(C[C@@H]1CNC(C)=O)C2=CC=C(N3CCOCC3)C(F)=C2 |
| Formula: | C16H20FN3O4 |
| M.Wt: | 337.35 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Linezolid (PNU-100766) is a synthetic antibiotic used for the treatment of serious infections caused by Gram-positive bacteria that are resistant to several other antibiotics. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
