| Cas No.: | 637-32-1 |
| Chemical Name: | Proguanil Hydrochloride |
| Synonyms: | Proguanil Hydrochloride;Chloroguanide hydrochloride;Chlorguanide Hydrochloride;Imidodicarbonimidicdiamide, N-(4-chlorophenyl)-N'-(1-methylethyl)-, hydrochloride (1:1);Chlorguanide;N1-(4-Chlorophenyl)-N5-isopropylbiguanide |
| SMILES: | CC(C)NC(=N)NC(=N)NC1=CC=C(C=C1)Cl.Cl |
| Formula: | C11H16N5Cl.HCl |
| M.Wt: | 290.19218 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
