| Cas No.: | 903864-87-9 |
| Chemical Name: | ethyl 2-(4-methylpiperazine-1-carboxamido)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| Synonyms: | SMU-127;ZINC666243 |
| SMILES: | C12CCCC=1C(C(OCC)=O)=C(NC(N1CCN(C)CC1)=O)S2 |
| Formula: | C16H23N3O3S |
| M.Wt: | 337.438 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SMU127 (SMU-127, ZINC666243) is a specific TLR1-TLR2 small molecule agonist with EC50 of 0.55 uM; stimulates NF-κB activation and promotes TNFα secretion in human macrophages and mononuclear cells, inhibits the growth of breast cancer tumors in BABL/c mice. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
