| Cas No.: | 1627607-88-8 |
| Chemical Name: | (1S)-1-[[3-(Trifluoromethyl)phenyl]methyl]-2-oxo-2-(1-pyrrolidinyl)ethyl]1,2,3,4-tetrahydro-6-isoquinolinesulfonamide hydrochloride |
| Synonyms: | PFI2,PFI-2,SPFI2,SPFI-2,PFI 2,SPFI 2,S-PFI-2 |
| SMILES: | C1CN(C([C@H](NS(C2C=C3C(CNCC3)=C(F)C=2)(=O)=O)CC2C=CC=C(C(F)(F)F)C=2)=O)CC1.Cl |
| Formula: | C23H25F4N3O3S.HCl |
| M.Wt: | 535.98 |
| Purity: | >97% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Negative control of (R)-PFI 2 hydrochloride. Exhibits 500-fold lower activity in a SETD7 enzymatic assay (IC50 = 1 μM) compared to the active enantiomer. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
