| Cas No.: | 1448874-96-1 |
| Chemical Name: | Ansornitinib |
| Synonyms: | 1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 2,3-dihydro-3-[[[4-[methyl[2-(4-methyl-1-piperazinyl)acetyl]amino]phenyl]amino]phenylmethylene]-2-oxo-, methyl ester, (3Z)-;ansornitinib |
| SMILES: | C(/C1C=CC=CC=1)(=C1\C(NC2=NC(C(=O)OC)=CC=C\12)=O)\NC1C=CC(N(C)C(=O)CN2CCN(C)CC2)=CC=1 |
| Formula: | C30H32N6O4 |
| M.Wt: | 540.61 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
