| Cas No.: | 1933514-13-6 |
| Chemical Name: | Sebetralstat |
| Synonyms: | Sebetralstat;O5ZD2TU2B7;Sebetralstat [INN];BDBM408717;US10364238, Example 41;1H-Pyrazole-4-carboxamide, N-((3-fluoro-4-methoxy-2-pyridinyl)methyl)-3-(methoxymethyl)-1-((4-((2-oxo-1(2H)-pyridinyl)methyl)phenyl)methyl)-;N-((3-Fluoro-4-methoxy-2-pyridinyl)methyl)-3-(methoxymethyl)-1-((4-((2-oxo-1(2H)-pyridinyl)methyl)phenyl)methyl)-1H-pyrazole-4-carboxamide;N-((3-Fluoro-4-methoxypyridin-2-yl) methyl)-3-(methoxymethyl)-1-((4-((2-oxo-1,2-dihydrop |
| SMILES: | FC1=C(C=CN=C1CNC(C1=CN(CC2C=CC(=CC=2)CN2C=CC=CC2=O)N=C1COC)=O)OC |
| Formula: | C26H26FN5O4 |
| M.Wt: | 491.514149188995 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
