| Cas No.: | 701932-26-5 |
| Chemical Name: | Zelpolib |
| Synonyms: | Zelpolib;Methyl 2-(2-(3-(3,4-dihydroxyphenyl)propanoyl)hydrazine-1-carbothioamido)-5-phenylthiophene-3-carboxylate;STK457409;ST50849816;methyl 2-[({[3-(3,4-dihydroxyphenyl)propanoylamino]amino}thioxomethyl)amino]-5 -phenylthiophene-3-carboxylate;methyl 2-[({2-[3-(3,4-dihydroxyphenyl)propanoyl]hydrazinyl}carbonothioyl)amino]-5-phenylthiophene-3-carboxylate |
| SMILES: | S1C(=C(C(=O)OC([H])([H])[H])C([H])=C1C1C([H])=C([H])C([H])=C([H])C=1[H])N([H])C(N([H])N([H])C(C([H])([H])C([H])([H])C1C([H])=C([H])C(=C(C=1[H])O[H])O[H])=O)=S |
| Formula: | C22H21N3O5S2 |
| M.Wt: | 471.5492 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
