| Cas No.: | 1973408-76-2 |
| Chemical Name: | ABM-14 |
| Synonyms: | ABM-14 |
| SMILES: | C1C=C(O)C=CC=1C1C=CC(N2C(C)(C(N(C3=CC(C(F)(F)F)=C(N)C=C3)C2=S)=O)C)=CC=1 |
| Formula: | C24H20F3N3O2S |
| M.Wt: | 471.494714736938 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
