| Cas No.: | 1286279-29-5 |
| Chemical Name: | N-[(1R,2S,5R)-5-[(1,1-Dimethylethyl)amino]-2-[(3S)-3-[[7-(1,1-dimethylethyl)pyrazolo[1,5-a]-1,3,5-triazin-4-yl]amino]-2-oxo-1-pyrrolidinyl]cyclohexyl]acetamide |
| Synonyms: | BMS-813160,BMS813160,BMS 813160 |
| SMILES: | CC(N[C@H]1[C@@H](N2C([C@@H](NC3=NC=NC4=CC(C(C)(C)C)=NN43)CC2)=O)CC[C@@H](NC(C)(C)C)C1)=O |
| Formula: | C25H40N8O2 |
| M.Wt: | 484.64 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BMS-813160 is the first dual CCR2/CCR5 antagonist to enter clinical development for cardiovascular. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
