| Cas No.: | 195514-23-9 |
| Chemical Name: | 2-(3-((R)-3-(3,4-dimethoxyphenyl)-1-(((S)-1-((S)-2-(3,4,5-trimethoxyphenyl)butanoyl)piperidine-2-carbonyl)oxy)propyl)phenoxy)acetic acid |
| Synonyms: | AP1867;AP1867;AP1867 |
| SMILES: | COC1C(OC)=CC(CC[C@H](C2C=C(OCC(=O)O)C=CC=2)OC(=O)[C@H]2N(C(=O)[C@@H](CC)C3C=C(OC)C(OC)=C(OC)C=3)CCCC2)=CC=1 |
| Formula: | C38H47NO11 |
| M.Wt: | 693.77 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Nabet B, et al. The dTAG system for immediate and target-specific protein degradation. Nat Chem Biol. 2018 May;14(5):431-441. |
| Description: | AP1867 is a synthetic FKBP12F36V-directed ligand. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
