| Cas No.: | 1970972-74-7 |
| Chemical Name: | 4-{(1R)-1-[3-(difluoromethyl)-1-methyl-1H-pyrazole-4-sulfonyl]-1-fluoroethyl}-N-(1,2-oxazol-3-yl)piperidine-1-carboxamide |
| Synonyms: | Danicamtiv|MYK491|MYK-491|MYK 491 |
| SMILES: | FC(C1CCN(C(NC2=NOC=C2)=O)CC1)(C)S(C3=CN(C)N=C3C(F)F)(=O)=O |
| Formula: | C16H20F3N5O4S |
| M.Wt: | 435.422 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: | [1]. Sarah Fernandes, et al. Abstract 15707: MYK-491, a Novel Small-Molecule Cardiac Myosin Activator Increases Cardiac Systolic Function and Preserves Mechanical Efficiency: Pre-Clinical in vivo and in vitro Evidence. Circulation. 2019;140:A15707 [2]. V |
| Description: | Danicamtiv is a positive inotropic agent. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
