| Cas No.: | 1835705-57-1 |
| Chemical Name: | (S,R,S)-AHPC-PEG2-C4-Cl |
| Synonyms: | VH032-PEG2-C4-Cl; VHL Ligand-Linker Conjugates 7; E3 ligase Ligand-Linker Conjugates 10 |
| SMILES: | CC1=C(C2=CC=C(CNC(=O)C3C[C@@H](O)CN3C(=O)[C@@H](NC(=O)COCCOCCCCCCCl)C(C)(C)C)C=C2)SC=N1 |
| Formula: | C32H47ClN4O6S |
| M.Wt: | 651.26 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
-AHPC-PEG2-C4-Cl.gif)