| Cas No.: | 2171519-15-4 |
| Chemical Name: | Desamino lenalidomide-5-COOH |
| Synonyms: | Desamino lenalidomide 5 COOH |
| SMILES: | O=C1CCC(N2CC3=C(C=C(C(=O)O)C=C3)C2=O)C(=O)N1 |
| Formula: | C14H12N2O5 |
| M.Wt: | 288.26 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
