| Cas No.: | 942206-85-1 |
| Chemical Name: | (N-((1S)-1-{[4-((2S)-2-{[(2,4-Dichlorophenyl)sulfonyl]amino}-3-hydroxypropanoyl)-1-piperazinyl]carbonyl}-3-methylbutyl)-1-benzothiophene-2-carboxamide |
| Synonyms: | GSK1016790A,GSK-1016790A,GSK 1016790A |
| SMILES: | CC(C)C[C@@H](C(=O)N1CCN(CC1)C(=O)[C@H](CO)NS(=O)(=O)C2=C(C=C(C=C2)Cl)Cl)NC(=O)C3=CC4=CC=CC=C4S3 |
| Formula: | C28H32Cl2N4O6S2 |
| M.Wt: | 655.61 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GSK1016790A is a potent transient receptor potential vanilloid 4 (TRPV4) activator. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
