| Cas No.: | 883031-03-6 |
| Chemical Name: | 2-Methyl-1-(3-morpholin-4-ylpropyl)-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| Synonyms: | HC 067047;HC-067047;2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide;2-Methyl-1-[3-(4-morpholinyl)propyl]-5-phenyl-N-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carboxamide;HC067047;MLS006012019;GTPL4213;AOB5050;ONC 212;HMS3743C07;BCP34020;BDBM50192821;s6637;SMR0047035 |
| SMILES: | FC(C1C([H])=C([H])C([H])=C(C=1[H])N([H])C(C1C([H])=C(C2C([H])=C([H])C([H])=C([H])C=2[H])N(C=1C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H])=O)(F)F |
| Formula: | C26H28F3N3O2 |
| M.Wt: | 471.5146 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | HC-067047 is a potent and selective TRPV4 antagonist with IC50s of 48 nM, 133 nM, and 17 nM for human, rat, and mouse TRPV4. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
