| Cas No.: | 752187-80-7 |
| Chemical Name: | CP 544326 |
| Synonyms: | CP 544326;Taprenepag;2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]phenoxy]acetic acid;AGN-PC-01V6VT;CHEMBL2107783;CP-544326;SureCN3318549;Taprenepag [USAN:INN];Taprenepagum;UNII-9CD894KUMJ |
| SMILES: | O=S(C1=CN=CC=C1)(N(CC2=CC(OCC(O)=O)=CC=C2)CC3=CC=C(N4C=CC=N4)C=C3)=O |
| Formula: | C24H22N4O5S |
| M.Wt: | 478.52028 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CP-544326 is a potent and selective prostaglandin E2 receptor agonist with an EC50 of 2.8 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
