| Cas No.: | 956958-53-5 |
| Chemical Name: | N-(3-(benzo[c][1,2,5]thiadiazol-5-ylamino)quinoxalin-2-yl)-4-methylbenzenesulfonamide |
| Synonyms: | XL-147,XL 147 |
| SMILES: | C(S(NC1C(NC2C=CC3C(C=2)=NSN=3)=NC2C(N=1)=CC=CC=2)(=O)=O)1=CC=C(C)C=C1 |
| Formula: | C21H16N6O2S2 |
| M.Wt: | 448.52 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pilaralisib analogue (XL147 analogue) is a representative and selective PI3Kα inhibitor extracted from patent WO2012006552A1, Compound 147 in Table 1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
