| Cas No.: | 1927857-55-3 |
| Chemical Name: | PQR514 |
| Synonyms: | 2-Pyrimidinamine, 4-(difluoromethyl)-5-(4,6-di-4-morpholinyl-1,3,5-triazin-2-yl)- |
| SMILES: | C1(N)=NC=C(C2=NC(N3CCOCC3)=NC(N3CCOCC3)=N2)C(C(F)F)=N1 |
| Formula: | C16H20F2N8O2 |
| M.Wt: | 394.379208564758 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
