| Cas No.: | 1923833-60-6 |
| Chemical Name: | BMS-986205 |
| Synonyms: | Linrodostat;BMS986205;(R)-N-(4-chlorophenyl)-2-((1s,4S)-4-(6-fluoroquinolin-4-yl)cyclohexyl)propanamide;0A7729F42K;Linrodostat (USAN);(2R)-N-(4-chlorophenyl)-2-[cis-4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide;C24H24ClFN2O;GTPL9707;ONO 7701;BDBM50285416;NSC799771;s8629;BMS |
| SMILES: | ClC1C=CC(=CC=1)NC([C@H](C)C1CCC(C2C=CN=C3C=CC(=CC=23)F)CC1)=O |
| Formula: | C24H24ClFN2O |
| M.Wt: | 410.9116 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BMS-986205 is a selective indoleamine 2,3-dioxygenase 1 (IDO1) inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
